Showing entry for Juarezic Acid
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0042330 |
| Compound Name | Juarezic Acid |
| Structure | ![]() |
| Formula | C11H10O2 |
| InchiKey | FEIQOMCWGDNMHM-KBXRYBNXSA-N |
| SMILES | OC(=O)/C=C/C=C/c1ccccc1 |
| Inchi | InChI=1S/C11H10O2/c12-11(13)9-5-4-8-10-6-2-1-3-7-10/h1-9H,(H,12,13)/b8-4+,9-5+ |
| IUPAC | (2E,4E)-5-phenylpenta-2,4-dienoic acid |
| Molecular Weight | 174.07 |
| Pubchem Id | 1549512 |
| Chembl Id | CHEMBL1095566 |
| Targets of Information Source | |||||||||||||||||||||||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||
| PDB | n.a |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL1095566 |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||||||||||||||||||||||||||||||||||||||||||
| Foods |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
