Showing entry for Lonijaposide M
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0042331 |
| Compound Name | Lonijaposide M |
| Structure | ![]() |
| Formula | C25H31NO11 |
| InchiKey | UEEFSWPSRLSUQJ-NOMYRAODSA-N |
| SMILES | C=C[C@H]1[C@@H](OC=C([C@H]1/C=C/c1ccc[n+](c1)CCCC(=O)O)C(=O)[O-])O[C@@H]1O[C@H](CO)[C@H]([C@@H]([C@H]1O)O)O |
| Inchi | InChI=1S/C25H31NO11/c1-2-15-16(8-7-14-5-3-9-26(11-14)10-4-6-19(28)29)17(23(33)34)13-35-24(15)37-25-22(32)21(31)20(30)18(12-27)36-25/h2-3,5,7-9,11,13,15-16,18,20-22,24-25,27,30-32H,1,4,6,10,12H2,(H-,28,29,33,34)/b8-7+/t15-,16+,18-,20-,21+,22-,24+,25+/m1/s1 |
| IUPAC | |
| Molecular Weight | 521.19 |
| Pubchem Id | 56599874 |
| Chembl Id | CHEMBL1928051 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL1928051 |
|
||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||
| Foods |
|
||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
