Showing entry for 1,8-Dihydroxy-3-Methyl-4A,9A-Dihydroanthracene-9,10-Dione
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0042340 |
| Compound Name | 1,8-Dihydroxy-3-Methyl-4A,9A-Dihydroanthracene-9,10-Dione |
| Structure | ![]() |
| Formula | C15H12O4 |
| InchiKey | RJOOIZGQOJJWMS-UHFFFAOYSA-N |
| SMILES | CC1=CC2C(C(=C1)O)C(=O)c1c(C2=O)cccc1O |
| Inchi | InChI=1S/C15H12O4/c1-7-5-9-13(11(17)6-7)15(19)12-8(14(9)18)3-2-4-10(12)16/h2-6,9,13,16-17H,1H3 |
| IUPAC | 1,8-dihydroxy-3-methyl-4a,9a-dihydroanthracene-9,10-dione |
| Molecular Weight | 256.07 |
| Pubchem Id | 24867638 |
| Chembl Id | CHEMBL443640 |
| Targets of Information Source | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| PDB | n.a |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL443640 |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Foods |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
