Showing entry for n.a
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0042348 |
| Compound Name | n.a |
| Structure | ![]() |
| Formula | C31H32O16 |
| InchiKey | XVRZYODGITYIQZ-CACQTGHNSA-N |
| SMILES | COC(=O)[C@]1(O)C[C@@H](OC(=O)/C=C/c2ccc(c(c2)O)O)[C@H]([C@@H](C1)OC(=O)/C=C/c1ccc(c(c1)O)O)OC(=O)C(CC(=O)O)(O)C |
| Inchi | InChI=1S/C31H32O16/c1-30(42,15-24(36)37)28(40)47-27-22(45-25(38)9-5-16-3-7-18(32)20(34)11-16)13-31(43,29(41)44-2)14-23(27)46-26(39)10-6-17-4-8-19(33)21(35)12-17/h3-12,22-23,27,32-35,42-43H,13-15H2,1-2H3,(H,36,37)/b9-5+,10-6+/t22-,23-,27-,30?,31+/m1/s1 |
| IUPAC | |
| Molecular Weight | 660.17 |
| Pubchem Id | |
| Chembl Id | CHEMBL446012 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL446012 |
|
||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||
| Foods |
|
||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
