Showing entry for 2,3-bis(3'-hydroxybenzyl)butane-1,4-diol
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0042379 |
| Compound Name | 2,3-bis(3'-hydroxybenzyl)butane-1,4-diol |
| Structure | ![]() |
| Formula | C18H22O4 |
| InchiKey | DWONJCNDULPHLV-HOTGVXAUSA-N |
| SMILES | OC[C@@H]([C@@H](Cc1cccc(c1)O)CO)Cc1cccc(c1)O |
| Inchi | InChI=1S/C18H22O4/c19-11-15(7-13-3-1-5-17(21)9-13)16(12-20)8-14-4-2-6-18(22)10-14/h1-6,9-10,15-16,19-22H,7-8,11-12H2/t15-,16-/m0/s1 |
| IUPAC | |
| Molecular Weight | 302.15 |
| Pubchem Id | 115089 |
| Chembl Id | CHEMBL471076 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL471076 |
|
||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||
| Foods |
|
||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
