Showing entry for vasicinone
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0042400 |
| Compound Name | vasicinone |
| Structure | ![]() |
| Formula | C11H10N2O2 |
| InchiKey | SDIVYZXRQHWCKF-UHFFFAOYSA-N |
| SMILES | OC1CCn2c1nc1ccccc1c2=O |
| Inchi | InChI=1S/C11H10N2O2/c14-9-5-6-13-10(9)12-8-4-2-1-3-7(8)11(13)15/h1-4,9,14H,5-6H2 |
| IUPAC | |
| Molecular Weight | 202.07 |
| Pubchem Id | 10242 |
| Chembl Id | CHEMBL1864065 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL1864065 |
|
||||||||||||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||
| Foods |
|
||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
