Showing entry for Lonijaposide I
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0042420 |
| Compound Name | Lonijaposide I |
| Structure | ![]() |
| Formula | C23H29NO10 |
| InchiKey | FNYPZWBJPFEVFN-YLCGFITOSA-N |
| SMILES | OCC[n+]1cccc(c1)/C=C/[C@H]1[C@@H](C=C)[C@@H](OC=C1C(=O)[O-])O[C@@H]1O[C@H](CO)[C@H]([C@@H]([C@H]1O)O)O |
| Inchi | InChI=1S/C23H29NO10/c1-2-14-15(6-5-13-4-3-7-24(10-13)8-9-25)16(21(30)31)12-32-22(14)34-23-20(29)19(28)18(27)17(11-26)33-23/h2-7,10,12,14-15,17-20,22-23,25-29H,1,8-9,11H2/b6-5+/t14-,15+,17-,18-,19+,20-,22+,23+/m1/s1 |
| IUPAC | |
| Molecular Weight | 479.18 |
| Pubchem Id | 56598336 |
| Chembl Id | CHEMBL1928047 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL1928047 |
|
||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||
| Foods |
|
||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
