Showing entry for Lonijaposide N
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0042439 |
| Compound Name | Lonijaposide N |
| Structure | ![]() |
| Formula | C26H33NO11 |
| InchiKey | PJIVLFIKRZQZOE-URGZVSNXSA-N |
| SMILES | C=C[C@H]1[C@@H](OC=C([C@H]1/C=C/c1ccc[n+](c1)CCCC(=O)[O-])C(=O)OC)O[C@@H]1O[C@H](CO)[C@H]([C@@H]([C@H]1O)O)O |
| Inchi | InChI=1S/C26H33NO11/c1-3-16-17(9-8-15-6-4-10-27(12-15)11-5-7-20(29)30)18(24(34)35-2)14-36-25(16)38-26-23(33)22(32)21(31)19(13-28)37-26/h3-4,6,8-10,12,14,16-17,19,21-23,25-26,28,31-33H,1,5,7,11,13H2,2H3/b9-8+/t16-,17+,19-,21-,22+,23-,25+,26+/m1/s1 |
| IUPAC | |
| Molecular Weight | 535.21 |
| Pubchem Id | 56600069 |
| Chembl Id | CHEMBL1928052 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL1928052 |
|
||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||
| Foods |
|
||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
