Showing entry for Lonijaposide L
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0042478 |
| Compound Name | Lonijaposide L |
| Structure | ![]() |
| Formula | C24H29NO11 |
| InchiKey | ONSYQRQUUDJRLS-IRTUFKDUSA-N |
| SMILES | C=C[C@H]1[C@@H](OC=C([C@H]1/C=C/c1ccc[n+](c1)CCC(=O)O)C(=O)[O-])O[C@@H]1O[C@H](CO)[C@H]([C@@H]([C@H]1O)O)O |
| Inchi | InChI=1S/C24H29NO11/c1-2-14-15(6-5-13-4-3-8-25(10-13)9-7-18(27)28)16(22(32)33)12-34-23(14)36-24-21(31)20(30)19(29)17(11-26)35-24/h2-6,8,10,12,14-15,17,19-21,23-24,26,29-31H,1,7,9,11H2,(H-,27,28,32,33)/b6-5+/t14-,15+,17-,19-,20+,21-,23+,24+/m1/s1 |
| IUPAC | |
| Molecular Weight | 507.17 |
| Pubchem Id | 56599872 |
| Chembl Id | CHEMBL1928050 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL1928050 |
|
||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||
| Foods |
|
||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
