Showing entry for endiandramide B, rel-
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0042485 |
| Compound Name | endiandramide B, rel- |
| Structure | ![]() |
| Formula | C26H33NO3 |
| InchiKey | MZNYKIXDEPFZJF-VOMQUASUSA-N |
| SMILES | CC(CN=C([C@H]1[C@H]2C=C[C@@H]3[C@@H]1C[C@H]1[C@@H]([C@@H]2[C@@H]31)CCCc1ccc2c(c1)OCO2)O)C |
| Inchi | InChI=1S/C26H33NO3/c1-14(2)12-27-26(28)25-18-8-7-17-20(25)11-19-16(23(18)24(17)19)5-3-4-15-6-9-21-22(10-15)30-13-29-21/h6-10,14,16-20,23-25H,3-5,11-13H2,1-2H3,(H,27,28)/t16-,17+,18-,19-,20-,23-,24-,25-/m0/s1 |
| IUPAC | |
| Molecular Weight | 407.25 |
| Pubchem Id | 56658431 |
| Chembl Id | CHEMBL1821990 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||||||||||||||||||||||
| Binding DB | 50353027 |
|
||||||||||||||||||||||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL1821990 |
|
||||||||||||||||||||||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||
| Foods |
|
||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
