Showing entry for 3-hydroxyaspartic acid
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0042495 |
| Compound Name | 3-hydroxyaspartic acid |
| Structure | ![]() |
| Formula | C4H7NO5 |
| InchiKey | YYLQUHNPNCGKJQ-UHFFFAOYSA-N |
| SMILES | OC(=O)C(C(C(=O)O)N)O |
| Inchi | InChI=1S/C4H7NO5/c5-1(3(7)8)2(6)4(9)10/h1-2,6H,5H2,(H,7,8)(H,9,10) |
| IUPAC | |
| Molecular Weight | 149.03 |
| Pubchem Id | 5425 |
| Chembl Id | CHEMBL3039080 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL3039080 |
|
||||||||||||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||
| Foods |
|
||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
