Showing entry for Benzoylgomisin H
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0042504 |
| Compound Name | Benzoylgomisin H |
| Structure | ![]() |
| Formula | C30H34O8 |
| InchiKey | AZQOQICAWOAGEN-UHFFFAOYSA-N |
| SMILES | COc1c(OC)cc2c(c1OC(=O)c1ccccc1)c1c(cc(c(c1OC)OC)OC)CC(C(C2)C)(C)O |
| Inchi | InChI=1S/C30H34O8/c1-17-13-19-14-21(33-3)26(36-6)28(38-29(31)18-11-9-8-10-12-18)23(19)24-20(16-30(17,2)32)15-22(34-4)25(35-5)27(24)37-7/h8-12,14-15,17,32H,13,16H2,1-7H3 |
| IUPAC | |
| Molecular Weight | 522.23 |
| Pubchem Id | 44575227 |
| Chembl Id | CHEMBL519932 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL519932 |
|
||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||
| Foods |
|
||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
