Showing entry for Lonijaposide H
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0042518 |
| Compound Name | Lonijaposide H |
| Structure | ![]() |
| Formula | C27H33NO13 |
| InchiKey | UVMYLENKGIUJAG-ICNBXRGLSA-N |
| SMILES | C=C[C@H]1[C@@H](OC=C(/C/1=C/Cc1c[n+](CCCC(=O)O)cc(c1)C(=O)[O-])C(=O)OC)O[C@@H]1O[C@H](CO)[C@H]([C@@H]([C@H]1O)O)O |
| Inchi | InChI=1S/C27H33NO13/c1-3-16-17(7-6-14-9-15(24(35)36)11-28(10-14)8-4-5-20(30)31)18(25(37)38-2)13-39-26(16)41-27-23(34)22(33)21(32)19(12-29)40-27/h3,7,9-11,13,16,19,21-23,26-27,29,32-34H,1,4-6,8,12H2,2H3,(H-,30,31,35,36)/b17-7+/t16-,19-,21-,22+,23-,26+,27+/ |
| IUPAC | |
| Molecular Weight | 579.2 |
| Pubchem Id | 56599868 |
| Chembl Id | CHEMBL1928046 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL1928046 |
|
||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||
| Foods |
|
||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
