Showing entry for n.a
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0042523 |
| Compound Name | n.a |
| Structure | ![]() |
| Formula | C26H32O8 |
| InchiKey | WIZTTYONBFRXCA-NHDPSOOVSA-N |
| SMILES | COc1cc(O)c(c(c1C(=O)/C(=C/c1ccc(cc1O)O)/O)O)CC(C(=C)C)CCC(O)(C)C |
| Inchi | InChI=1S/C26H32O8/c1-14(2)15(8-9-26(3,4)33)10-18-20(29)13-22(34-5)23(24(18)31)25(32)21(30)11-16-6-7-17(27)12-19(16)28/h6-7,11-13,15,27-31,33H,1,8-10H2,2-5H3/b21-11- |
| IUPAC | |
| Molecular Weight | 472.21 |
| Pubchem Id | 118732443 |
| Chembl Id | CHEMBL3410512 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL3410512 |
|
||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||
| Foods |
|
||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
