Showing entry for Lonijaposide J
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0042532 |
| Compound Name | Lonijaposide J |
| Structure | ![]() |
| Formula | C24H32NO10.ClH |
| InchiKey | NXVSHRKSOYHAHU-GVTJHXRVSA-M |
| SMILES | OCC[n+]1cccc(c1)/C=C/[C@H]1[C@@H](C=C)[C@@H](OC=C1C(=O)OC)O[C@@H]1O[C@H](CO)[C@H]([C@@H]([C@H]1O)O)O.[Cl-] |
| Inchi | InChI=1S/C24H32NO10.ClH/c1-3-15-16(7-6-14-5-4-8-25(11-14)9-10-26)17(22(31)32-2)13-33-23(15)35-24-21(30)20(29)19(28)18(12-27)34-24;/h3-8,11,13,15-16,18-21,23-24,26-30H,1,9-10,12H2,2H3;1H/q+1;/p-1/b7-6+;/t15-,16+,18-,19-,20+,21-,23+,24+;/m1./s1 |
| IUPAC | |
| Molecular Weight | 494.2 |
| Pubchem Id | 56599869 |
| Chembl Id | CHEMBL1928048 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL1928048 |
|
||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||
| Foods |
|
||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
