Showing entry for Lonijaposide F
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0042537 |
| Compound Name | Lonijaposide F |
| Structure | ![]() |
| Formula | C24H29NO11 |
| InchiKey | KKLONPANWKAOPP-DFEUVTCYSA-N |
| SMILES | C=C[C@H]1[C@@H](OC=C([C@H]1/C=C/c1c[n+](CC)cc(c1)C(=O)O)C(=O)[O-])O[C@@H]1O[C@H](CO)[C@H]([C@@H]([C@H]1O)O)O |
| Inchi | InChI=1S/C24H29NO11/c1-3-14-15(6-5-12-7-13(21(30)31)9-25(4-2)8-12)16(22(32)33)11-34-23(14)36-24-20(29)19(28)18(27)17(10-26)35-24/h3,5-9,11,14-15,17-20,23-24,26-29H,1,4,10H2,2H3,(H-,30,31,32,33)/b6-5+/t14-,15+,17-,18-,19+,20-,23+,24+/m1/s1 |
| IUPAC | |
| Molecular Weight | 507.17 |
| Pubchem Id | 56599668 |
| Chembl Id | CHEMBL1928044 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL1928044 |
|
||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||
| Foods |
|
||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
