Showing entry for 1,10:2,3-diepoxy-6,8-dihydroxy-11-vinylgermacr-4-ene 12,14-di-gamma-lactone
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0042960 |
| Compound Name | 1,10:2,3-diepoxy-6,8-dihydroxy-11-vinylgermacr-4-ene 12,14-di-gamma-lactone |
| Structure | ![]() |
| Formula | C15H14O6 |
| InchiKey | JRZGAAFGODYEEA-UHFFFAOYSA-N |
| SMILES | O=C1OC2C=C1C1OC1C1OC1(CC1C2C(=C)C(=O)O1)C |
| Inchi | InChI=1S/C15H14O6/c1-5-9-7-3-6(14(17)18-7)10-11(20-10)12-15(2,21-12)4-8(9)19-13(5)16/h3,7-12H,1,4H2,2H3 |
| IUPAC | |
| Molecular Weight | 290.08 |
| Pubchem Id | 5140086 |
| Chembl Id | CHEMBL1978882 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||
| Binding DB | 94064 |
|
||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL1978882 |
|
||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||||||
| Foods |
|
||||||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
