Showing entry for inophyllum B
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0043215 |
| Compound Name | inophyllum B |
| Structure | ![]() |
| Formula | C25H24O5 |
| InchiKey | BXENDTPSKAICGV-ZMOMAAQPSA-N |
| SMILES | C[C@H]1Oc2c3C=CC(Oc3c3c(c2[C@@H]([C@@H]1C)O)oc(=O)cc3c1ccccc1)(C)C |
| Inchi | InChI=1S/C25H24O5/c1-13-14(2)28-22-16-10-11-25(3,4)30-23(16)19-17(15-8-6-5-7-9-15)12-18(26)29-24(19)20(22)21(13)27/h5-14,21,27H,1-4H3/t13-,14-,21-/m1/s1 |
| IUPAC | |
| Molecular Weight | 404.16 |
| Pubchem Id | 455249 |
| Chembl Id | CHEMBL422798 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL422798 |
|
||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||
| Foods |
|
||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
