Showing entry for neoechinulin A
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0043239 |
| Compound Name | neoechinulin A |
| Structure | ![]() |
| Formula | C19H21N3O2 |
| InchiKey | MYRPIYZIAHOECW-SAIXKJTDSA-N |
| SMILES | C=CC(c1[nH]c2c(c1/C=C/1\N=C(O)[C@@H](N=C1O)C)cccc2)(C)C |
| Inchi | InChI=1S/C19H21N3O2/c1-5-19(3,4)16-13(12-8-6-7-9-14(12)21-16)10-15-18(24)20-11(2)17(23)22-15/h5-11,21H,1H2,2-4H3,(H,20,24)(H,22,23)/b15-10-/t11-/m0/s1 |
| IUPAC | (3S,6Z)-3-methyl-6-[[2-(2-methylbut-3-en-2-yl)-1H-indol-3-yl]methylidene]piperazine-2,5-dione |
| Molecular Weight | 323.16 |
| Pubchem Id | 9996305 |
| Chembl Id | CHEMBL400768 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL400768 |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||||||||||||||
| Foods |
|
||||||||||||||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
