Showing entry for bemadienolide
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0043591 |
| Compound Name | bemadienolide |
| Structure | ![]() |
| Formula | C15H20O2 |
| InchiKey | IQJQVMRLNOWNDT-SWLSCSKDSA-N |
| SMILES | O=C1OCC2=C1C=C[C@@H]1[C@]2(C)CCCC1(C)C |
| Inchi | InChI=1S/C15H20O2/c1-14(2)7-4-8-15(3)11-9-17-13(16)10(11)5-6-12(14)15/h5-6,12H,4,7-9H2,1-3H3/t12-,15+/m0/s1 |
| IUPAC | (5aS,9aS)-6,6,9a-trimethyl-5a,7,8,9-tetrahydro-1H-benzo[e][2]benzofuran-3-one |
| Molecular Weight | 232.15 |
| Pubchem Id | 12300028 |
| Chembl Id | CHEMBL385842 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL385842 |
|
||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||
| Foods |
|
||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
