Showing entry for Pseudoionone
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0043628 |
| Compound Name | Pseudoionone |
| Structure | ![]() |
| Formula | C13H20O |
| InchiKey | JXJIQCXXJGRKRJ-KOOBJXAQSA-N |
| SMILES | C/C(=C\C=C\C(=O)C)/CCC=C(C)C |
| Inchi | InChI=1S/C13H20O/c1-11(2)7-5-8-12(3)9-6-10-13(4)14/h6-7,9-10H,5,8H2,1-4H3/b10-6+,12-9+ |
| IUPAC | (3E,5E)-6,10-dimethylundeca-3,5,9-trien-2-one |
| Molecular Weight | 192.15 |
| Pubchem Id | 1757003 |
| Chembl Id |
| Targets of Information Source | ||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||
| PDB | DXJ |
|
||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||
| CHEMBL | n.a |
|
||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||||||||||
| Foods |
|
||||||||||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
