Showing entry for salirepin
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0043668 |
| Compound Name | salirepin |
| Structure | ![]() |
| Formula | C13H18O8 |
| InchiKey | NPNFZOGKIFFKGT-UJPOAAIJSA-N |
| SMILES | OC[C@H]1O[C@@H](Oc2ccc(cc2CO)O)[C@@H]([C@H]([C@@H]1O)O)O |
| Inchi | InChI=1S/C13H18O8/c14-4-6-3-7(16)1-2-8(6)20-13-12(19)11(18)10(17)9(5-15)21-13/h1-3,9-19H,4-5H2/t9-,10-,11+,12-,13-/m1/s1 |
| IUPAC | |
| Molecular Weight | 302.1 |
| Pubchem Id | 16681676 |
| Chembl Id | CHEMBL468146 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL468146 |
|
||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||
| Foods |
|
||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
