Showing entry for pseudopalmatine
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0043713 |
| Compound Name | pseudopalmatine |
| Structure | ![]() |
| Formula | C21H22NO4 |
| InchiKey | CLFBXKHKECKSQM-UHFFFAOYSA-N |
| SMILES | COc1cc2CC[n+]3c(c2cc1OC)cc1c(c3)cc(c(c1)OC)OC |
| Inchi | InChI=1S/C21H22NO4/c1-23-18-8-13-5-6-22-12-15-10-20(25-3)19(24-2)9-14(15)7-17(22)16(13)11-21(18)26-4/h7-12H,5-6H2,1-4H3/q+1 |
| IUPAC | 2,3,10,11-tetramethoxy-5,6-dihydroisoquinolino[2,1-b]isoquinolin-7-ium |
| Molecular Weight | 352.15 |
| Pubchem Id | 644002 |
| Chembl Id | CHEMBL376300 |
| Targets of Information Source | |||||||||||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
|||||||||||||||||||||||||||||||||||||||
| PDB | n.a |
|
|||||||||||||||||||||||||||||||||||||||
| Binding DB | 50328694 |
|
|||||||||||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL376300 |
|
|||||||||||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||||||||||||||||||||||||||||||
| Foods |
|
||||||||||||||||||||||||||||||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
