Showing entry for 3-Amino-D-Alanine
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0044125 |
| Compound Name | 3-Amino-D-Alanine |
| Structure | ![]() |
| Formula | C3H8N2O2 |
| InchiKey | PECYZEOJVXMISF-UWTATZPHSA-N |
| SMILES | N[C@@H](C(=O)O)CN |
| Inchi | InChI=1S/C3H8N2O2/c4-1-2(5)3(6)7/h2H,1,4-5H2,(H,6,7)/t2-/m1/s1 |
| IUPAC | (2R)-2,3-diaminopropanoic acid |
| Molecular Weight | 104.06 |
| Pubchem Id | 638152 |
| Chembl Id | CHEMBL420464 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||
| PDB | 2RA |
|
||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL420464 |
|
||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||
| Foods |
|
||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
