Showing entry for 3-epi-perforenone A
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0044188 |
| Compound Name | 3-epi-perforenone A |
| Structure | ![]() |
| Formula | C15H22O2 |
| InchiKey | FUPXAIKSURJKNB-NILFDRSVSA-N |
| SMILES | CC1=CC[C@]2(C(=C(C)C(=O)[C@@H]([C@@H]2C)O)CC1)C |
| Inchi | InChI=1S/C15H22O2/c1-9-5-6-12-10(2)13(16)14(17)11(3)15(12,4)8-7-9/h7,11,14,17H,5-6,8H2,1-4H3/t11-,14+,15+/m0/s1 |
| IUPAC | (3R,4R,4aR)-3-hydroxy-1,4,4a,7-tetramethyl-4,5,8,9-tetrahydro-3H-benzo[7]annulen-2-one |
| Molecular Weight | 234.16 |
| Pubchem Id | 639667 |
| Chembl Id | CHEMBL478787 |
| Targets of Information Source | |||||||||||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
|||||||||||||||||||||||||||||||||||||||
| PDB | n.a |
|
|||||||||||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
|||||||||||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL478787 |
|
|||||||||||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||||||||||||||||||||||||||||||
| Foods |
|
||||||||||||||||||||||||||||||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
