Showing entry for demethyleneberberine
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0044218 |
| Compound Name | demethyleneberberine |
| Structure | ![]() |
| Formula | C19H17NO4 |
| InchiKey | HVTCKKMWZDDWOY-UHFFFAOYSA-O |
| SMILES | COc1c(OC)ccc2c1c[n+]1CCC3=CC(=O)C(=CC3=c1c2)O |
| Inchi | InChI=1S/C19H17NO4/c1-23-18-4-3-11-7-15-13-9-17(22)16(21)8-12(13)5-6-20(15)10-14(11)19(18)24-2/h3-4,7-10,22H,5-6H2,1-2H3/p+1 |
| IUPAC | 2-hydroxy-9,10-dimethoxy-6,7-dihydro-5H-isoquinolino[2,1-b]isoquinolin-7-ium-3-one |
| Molecular Weight | 324.12 |
| Pubchem Id | 363209 |
| Chembl Id | CHEMBL379449 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||||||||||||||||||||||
| Binding DB | 50300549 |
|
||||||||||||||||||||||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL379449 |
|
||||||||||||||||||||||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||||||||||||||||||||||||||||||||||
| Foods |
|
||||||||||||||||||||||||||||||||||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
