Showing entry for aristolochic acid B
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0044597 |
| Compound Name | aristolochic acid B |
| Structure | ![]() |
| Formula | C16H9NO6 |
| InchiKey | MEEXETVZNQYRSP-UHFFFAOYSA-N |
| SMILES | O=N(=O)c1cc2ccccc2c2c1c(cc1c2OCO1)C(=O)O |
| Inchi | InChI=1S/C16H9NO6/c18-16(19)10-6-12-15(23-7-22-12)14-9-4-2-1-3-8(9)5-11(13(10)14)17(20)21/h1-6H,7H2,(H,18,19) |
| IUPAC | 6-nitronaphtho[2,1-g][1,3]benzodioxole-5-carboxylic acid |
| Molecular Weight | 311.04 |
| Pubchem Id | 108168 |
| Chembl Id | CHEMBL602280 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||||||||||||
| Binding DB | 50306854 |
|
||||||||||||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL602280 |
|
||||||||||||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||||||||||||||||||||||||||||||
| Foods |
|
||||||||||||||||||||||||||||||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
