Showing entry for clausine C
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0044626 |
| Compound Name | clausine C |
| Structure | ![]() |
| Formula | C15H13NO3 |
| InchiKey | UHYHEIKZOWURQD-UHFFFAOYSA-N |
| SMILES | COc1ccc2c(c1)[nH]c1c2cc(cc1)C(=O)OC |
| Inchi | InChI=1S/C15H13NO3/c1-18-10-4-5-11-12-7-9(15(17)19-2)3-6-13(12)16-14(11)8-10/h3-8,16H,1-2H3 |
| IUPAC | |
| Molecular Weight | 255.09 |
| Pubchem Id | 11817681 |
| Chembl Id | CHEMBL1173128 |
| Targets of Information Source | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| PDB | n.a |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL1173128 |
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Foods |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
