Showing entry for 1,7-Dihydroxy-4-Methoxyxanthone
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0044656 |
| Compound Name | 1,7-Dihydroxy-4-Methoxyxanthone |
| Structure | ![]() |
| Formula | C14H10O5 |
| InchiKey | YDZGWMWSKOGVLG-UHFFFAOYSA-N |
| SMILES | COc1ccc(c2c1oc1ccc(cc1c2=O)O)O |
| Inchi | InChI=1S/C14H10O5/c1-18-11-5-3-9(16)12-13(17)8-6-7(15)2-4-10(8)19-14(11)12/h2-6,15-16H,1H3 |
| IUPAC | 1,7-dihydroxy-4-methoxyxanthen-9-one |
| Molecular Weight | 258.05 |
| Pubchem Id | 5465785 |
| Chembl Id | CHEMBL484030 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL484030 |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||||||||||||||||||
| Foods |
|
||||||||||||||||||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
