Showing entry for Cercosporin
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0044679 |
| Compound Name | Cercosporin |
| Structure | ![]() |
| Formula | C29H26O10 |
| InchiKey | DGAZLNHJYDOWLG-UHFFFAOYSA-N |
| SMILES | COC1=C(CC(O)C)c2c3C(=C(OC)C(=O)c4c3c3c5c2c(C1=O)c(O)cc5OCOc3cc4O)CC(O)C |
| Inchi | InChI=1S/C29H26O10/c1-10(30)5-12-18-19-13(6-11(2)31)29(37-4)27(35)21-15(33)8-17-23(25(19)21)22-16(38-9-39-17)7-14(32)20(24(18)22)26(34)28(12)36-3/h7-8,10-11,30-33H,5-6,9H2,1-4H3 |
| IUPAC | |
| Molecular Weight | 534.15 |
| Pubchem Id | |
| Chembl Id | CHEMBL1080283 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL1080283 |
|
||||||||||||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||
| Foods |
|
||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
