Showing entry for Plakortide F Acid
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0044686 |
| Compound Name | Plakortide F Acid |
| Structure | ![]() |
| Formula | C20H36O4 |
| InchiKey | KCBAKIPOBYUWOG-QIKPMYDRSA-N |
| SMILES | CC/C=C/C(CCC[C@]1(CC)OO[C@H]([C@H](C1)CC)CC(=O)O)CC |
| Inchi | InChI=1S/C20H36O4/c1-5-9-11-16(6-2)12-10-13-20(8-4)15-17(7-3)18(23-24-20)14-19(21)22/h9,11,16-18H,5-8,10,12-15H2,1-4H3,(H,21,22)/b11-9+/t16?,17-,18-,20-/m0/s1 |
| IUPAC | |
| Molecular Weight | 340.26 |
| Pubchem Id | 46879407 |
| Chembl Id | CHEMBL1081731 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL1081731 |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||
| Foods |
|
||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
