Showing entry for Inophyllum P Ac
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0044800 |
| Compound Name | Inophyllum P Ac |
| Structure | ![]() |
| Formula | C27H26O6 |
| InchiKey | DDHWWLULUFLVOI-GGOJBBCOSA-N |
| SMILES | CC(=O)O[C@@H]1[C@H](C)[C@@H](C)Oc2c1c1oc(=O)cc(c1c1c2C=CC(O1)(C)C)c1ccccc1 |
| Inchi | InChI=1S/C27H26O6/c1-14-15(2)30-24-18-11-12-27(4,5)33-25(18)21-19(17-9-7-6-8-10-17)13-20(29)32-26(21)22(24)23(14)31-16(3)28/h6-15,23H,1-5H3/t14-,15-,23-/m1/s1 |
| IUPAC | |
| Molecular Weight | 446.17 |
| Pubchem Id | 455257 |
| Chembl Id | CHEMBL132986 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL132986 |
|
||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||
| Foods |
|
||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
