Showing entry for tetramethyl(phenyl)[?]one
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0044804 |
| Compound Name | tetramethyl(phenyl)[?]one |
| Structure | ![]() |
| Formula | C25H22O4 |
| InchiKey | YZCOPLIKCIKRCM-OAHLLOKOSA-N |
| SMILES | CC1=Cc2c(O[C@@H]1C)c1C=CC(Oc1c1c2oc(=O)cc1c1ccccc1)(C)C |
| Inchi | InChI=1S/C25H22O4/c1-14-12-19-22(27-15(14)2)17-10-11-25(3,4)29-24(17)21-18(13-20(26)28-23(19)21)16-8-6-5-7-9-16/h5-13,15H,1-4H3/t15-/m1/s1 |
| IUPAC | |
| Molecular Weight | 386.15 |
| Pubchem Id | 455259 |
| Chembl Id | CHEMBL134252 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL134252 |
|
||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||
| Foods |
|
||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
