Showing entry for methoxy[?]one
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0044828 |
| Compound Name | methoxy[?]one |
| Structure | ![]() |
| Formula | C17H13NO2 |
| InchiKey | SMSXFIWLWPHHRL-UHFFFAOYSA-N |
| SMILES | COc1cc2CCN=C3c2c(c1)C(=O)c1c3cccc1 |
| Inchi | InChI=1S/C17H13NO2/c1-20-11-8-10-6-7-18-16-12-4-2-3-5-13(12)17(19)14(9-11)15(10)16/h2-5,8-9H,6-7H2,1H3 |
| IUPAC | |
| Molecular Weight | 263.09 |
| Pubchem Id | 14364356 |
| Chembl Id | CHEMBL1651054 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||||||||||||
| Binding DB | 50358009 |
|
||||||||||||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL1651054 |
|
||||||||||||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||
| Foods |
|
||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
