Showing entry for morusyunnansin C
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0044912 |
| Compound Name | morusyunnansin C |
| Structure | ![]() |
| Formula | C42H48O8 |
| InchiKey | DWQWYHOKGGVRQE-IJWGSBTBSA-N |
| SMILES | COc1ccc(c(c1CC=C(C)C)O)CCC(c1ccc(cc1O)O)c1cc(c(cc1O)O)[C@H]1CCc2c(O1)c(CC=C(C)C)c(cc2)OC |
| Inchi | InChI=1S/C42H48O8/c1-24(2)7-14-31-38(48-5)18-10-26(41(31)47)9-16-29(30-17-13-28(43)21-35(30)44)33-22-34(37(46)23-36(33)45)40-20-12-27-11-19-39(49-6)32(42(27)50-40)15-8-25(3)4/h7-8,10-11,13,17-19,21-23,29,40,43-47H,9,12,14-16,20H2,1-6H3/t29?,40-/m1/s1 |
| IUPAC | |
| Molecular Weight | 680.33 |
| Pubchem Id | 57333037 |
| Chembl Id | CHEMBL1951302 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL1951302 |
|
||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||
| Foods |
|
||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
