Showing entry for n.a
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0044928 |
| Compound Name | n.a |
| Structure | ![]() |
| Formula | C18H26O2 |
| InchiKey | HUEGMMWEUQMMTG-FOWTUZBSSA-N |
| SMILES | OCCc1ccc(cc1)OC/C=C(/CCC=C(C)C)\C |
| Inchi | InChI=1S/C18H26O2/c1-15(2)5-4-6-16(3)12-14-20-18-9-7-17(8-10-18)11-13-19/h5,7-10,12,19H,4,6,11,13-14H2,1-3H3/b16-12+ |
| IUPAC | |
| Molecular Weight | 274.19 |
| Pubchem Id | 70687713 |
| Chembl Id | CHEMBL2022668 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL2022668 |
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||
| Foods |
|
||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
