Showing entry for 6'-glucosyl-martynoside
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0045058 |
| Compound Name | 6'-glucosyl-martynoside |
| Structure | ![]() |
| Formula | C37H50O20 |
| InchiKey | FXFHFOSEURHWMO-JZULCJQESA-N |
| SMILES | OC[C@@H]1O[C@H](OC[C@H]2O[C@@H](OCCc3ccc(c(c3)O)OC)[C@@H]([C@H]([C@@H]2OC(=O)/C=C/c2ccc(c(c2)OC)O)O[C@H]2O[C@H](C)[C@H]([C@@H]([C@@H]2O)O)O)O)[C@H]([C@@H]([C@H]1O)O)O |
| Inchi | InChI=1S/C37H50O20/c1-16-26(42)28(44)31(47)37(53-16)57-34-32(48)36(51-11-10-18-5-8-21(49-2)20(40)12-18)55-24(15-52-35-30(46)29(45)27(43)23(14-38)54-35)33(34)56-25(41)9-6-17-4-7-19(39)22(13-17)50-3/h4-9,12-13,16,23-24,26-40,42-48H,10-11,14-15H2,1-3H3/b9-6+ |
| IUPAC | |
| Molecular Weight | 814.29 |
| Pubchem Id | 44429858 |
| Chembl Id | CHEMBL233094 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL233094 |
|
||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||||||
| Foods |
|
||||||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
