Showing entry for 12-Hydroxycurcumenol
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0045068 |
| Compound Name | 12-Hydroxycurcumenol |
| Structure | ![]() |
| Formula | C15H22O3 |
| InchiKey | DEZWKBHSCPUCDO-NZLQWCMJSA-N |
| SMILES | OC/C(=C/1\C[C@]23O[C@]1(O)C=C([C@@H]3CC[C@@H]2C)C)/C |
| Inchi | InChI=1S/C15H22O3/c1-9-6-15(17)13(10(2)8-16)7-14(18-15)11(3)4-5-12(9)14/h6,11-12,16-17H,4-5,7-8H2,1-3H3/b13-10+/t11-,12-,14-,15+/m0/s1 |
| IUPAC | |
| Molecular Weight | 250.16 |
| Pubchem Id | 71578718 |
| Chembl Id | CHEMBL2332422 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL2332422 |
|
||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||
| Foods |
|
||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
