Showing entry for Heyneanone B
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0045070 |
| Compound Name | Heyneanone B |
| Structure | ![]() |
| Formula | C15H24O4 |
| InchiKey | AGMVUQMPIYDZOG-PVPCMPRFSA-N |
| SMILES | O[C@H]1CC[C@@](C)(O)[C@H](O)CC(=C(C)C)C(=O)/C=C\1/C |
| Inchi | InChI=1S/C15H24O4/c1-9(2)11-8-14(18)15(4,19)6-5-12(16)10(3)7-13(11)17/h7,12,14,16,18-19H,5-6,8H2,1-4H3/b10-7-/t12-,14+,15+/m0/s1 |
| IUPAC | |
| Molecular Weight | 268.17 |
| Pubchem Id | 71578637 |
| Chembl Id | CHEMBL2332438 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL2332438 |
|
||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||
| Foods |
|
||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
