Showing entry for n.a
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0045072 |
| Compound Name | n.a |
| Structure | ![]() |
| Formula | C27H30O16 |
| InchiKey | QYRJNVCANQPMCH-BRRCEIDXSA-N |
| SMILES | Oc1ccc(cc1)c1oc2cc(O)c(c(c2c(=O)c1O[C@@H]1O[C@H](CO[C@H]2O[C@H](C)[C@H]([C@@H]([C@@H]2O)O)O)[C@H]([C@@H]([C@H]1O)O)O)O)O |
| Inchi | InChI=1S/C27H30O16/c1-8-15(30)20(35)22(37)26(40-8)39-7-13-17(32)21(36)23(38)27(42-13)43-25-19(34)14-12(6-11(29)16(31)18(14)33)41-24(25)9-2-4-10(28)5-3-9/h2-6,8,13,15,17,20-23,26-33,35-38H,7H2,1H3/t8-,13-,15-,17-,20+,21+,22+,23-,26+,27+/m1/s1 |
| IUPAC | |
| Molecular Weight | 610.15 |
| Pubchem Id | 44429734 |
| Chembl Id | CHEMBL233291 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL233291 |
|
||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||
| Foods |
|
||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
