Showing entry for n.a
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0045073 |
| Compound Name | n.a |
| Structure | ![]() |
| Formula | C26H34O11 |
| InchiKey | GAYKAIAESJROGN-JJFAMHGWSA-N |
| SMILES | OC[C@@H]1[C@@H](CO[C@H]1c1ccc(c(c1)OC)O)Cc1ccc(c(c1)OC)O[C@H]1O[C@@H](CO)[C@@H]([C@H]([C@@H]1O)O)O |
| Inchi | InChI=1S/C26H34O11/c1-33-19-9-14(4-5-17(19)29)25-16(10-27)15(12-35-25)7-13-3-6-18(20(8-13)34-2)36-26-24(32)23(31)22(30)21(11-28)37-26/h3-6,8-9,15-16,21-32H,7,10-12H2,1-2H3/t15-,16-,21+,22+,23-,24+,25+,26+/m1/s1 |
| IUPAC | |
| Molecular Weight | 522.21 |
| Pubchem Id | 44429873 |
| Chembl Id | CHEMBL233297 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL233297 |
|
||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||
| Foods |
|
||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
