Showing entry for n.a
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0045111 |
| Compound Name | n.a |
| Structure | ![]() |
| Formula | C40H34O14 |
| InchiKey | RZLBGVNPBMPJNW-KXNNMBPQSA-N |
| SMILES | COc1cc(ccc1O)c1oc2cc(O[C@@H]3O[C@H](COC(=O)/C=C/c4ccccc4)[C@H]([C@@H]([C@H]3O)OC(=O)/C=C/c3ccc(cc3)O)O)cc(c2c(=O)c1)O |
| Inchi | InChI=1S/C40H34O14/c1-49-31-17-24(11-14-27(31)42)30-20-29(44)36-28(43)18-26(19-32(36)52-30)51-40-38(48)39(54-35(46)16-10-23-7-12-25(41)13-8-23)37(47)33(53-40)21-50-34(45)15-9-22-5-3-2-4-6-22/h2-20,33,37-43,47-48H,21H2,1H3/b15-9+,16-10+/t33-,37-,38-,39+,40 |
| IUPAC | |
| Molecular Weight | 738.19 |
| Pubchem Id | 44429744 |
| Chembl Id | CHEMBL233697 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL233697 |
|
||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||
| Foods |
|
||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
