Showing entry for n.a
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0045115 |
| Compound Name | n.a |
| Structure | ![]() |
| Formula | C32H44O16 |
| InchiKey | PBLWZMSRSJTRHJ-SXCKUSEKSA-N |
| SMILES | OC[C@@H]1O[C@H](Oc2ccc(cc2OC)C[C@@H]2CO[C@H]([C@@H]2CO)c2ccc(c(c2)OC)O[C@H]2O[C@@H](CO)[C@@H]([C@H]([C@@H]2O)O)O)[C@H]([C@@H]([C@H]1O)O)O |
| Inchi | InChI=1S/C32H44O16/c1-42-20-8-14(3-5-18(20)45-31-28(40)26(38)24(36)22(11-34)47-31)7-16-13-44-30(17(16)10-33)15-4-6-19(21(9-15)43-2)46-32-29(41)27(39)25(37)23(12-35)48-32/h3-6,8-9,16-17,22-41H,7,10-13H2,1-2H3/t16-,17-,22+,23+,24+,25+,26-,27-,28+,29+,30+,31 |
| IUPAC | |
| Molecular Weight | 684.26 |
| Pubchem Id | 44429874 |
| Chembl Id | CHEMBL234142 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL234142 |
|
||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||
| Foods |
|
||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
