Showing entry for 16-Hydroxystemofoline
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0045126 |
| Compound Name | 16-Hydroxystemofoline |
| Structure | ![]() |
| Formula | C22H31NO6 |
| InchiKey | JKKBPOIOBQBDAG-PLLHREKUSA-N |
| SMILES | CCCC[C@@]12[C@@H]3C[C@@H]4N1CC[C@H]2[C@]1(O3)[C@@H]4[C@@H](C(O1)C1OC(=O)C(=C1OC)CO)C |
| Inchi | InChI=1S/C22H31NO6/c1-4-5-7-21-14-6-8-23(21)13-9-15(21)28-22(14)16(13)11(2)17(29-22)19-18(26-3)12(10-24)20(25)27-19/h11,13-17,19,24H,4-10H2,1-3H3/t11-,13-,14+,15-,16+,17?,19?,21+,22+/m0/s1 |
| IUPAC | |
| Molecular Weight | 405.22 |
| Pubchem Id | 73348356 |
| Chembl Id | CHEMBL2368528 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL2368528 |
|
||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||
| Foods |
|
||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
