Showing entry for 6Beta-Hydroxystemofoline
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0045127 |
| Compound Name | 6Beta-Hydroxystemofoline |
| Structure | ![]() |
| Formula | C22H31NO6 |
| InchiKey | UYJQMJHUNWUKTG-YLMSMMQMSA-N |
| SMILES | CCCC[C@@]12[C@H]3C[C@@H]4N1C[C@H]([C@H]2[C@]1(O3)[C@@H]4[C@@H](C(O1)C1OC(=O)C(=C1OC)C)C)O |
| Inchi | InChI=1S/C22H31NO6/c1-5-6-7-21-14-8-12-15-10(2)17(18-16(26-4)11(3)20(25)27-18)29-22(15,28-14)19(21)13(24)9-23(12)21/h10,12-15,17-19,24H,5-9H2,1-4H3/t10-,12-,13+,14+,15+,17?,18?,19+,21-,22-/m0/s1 |
| IUPAC | |
| Molecular Weight | 405.22 |
| Pubchem Id | 73345325 |
| Chembl Id | CHEMBL2368529 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL2368529 |
|
||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||
| Foods |
|
||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
