Showing entry for n.a
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0045154 |
| Compound Name | n.a |
| Structure | ![]() |
| Formula | C35H46O6 |
| InchiKey | ZGWIUHSCLOOVHO-HLIATGGQSA-N |
| SMILES | CC(=C)O[C@]12C[C@@H]([C@@H]([C@@H]1[C@@H](O)[C@]1([C@](C2=O)(C)[C@H](OC(=C)C)[C@@H]2[C@H](CC1)C2(C)C)C)OC(=O)/C=C/c1ccccc1)C |
| Inchi | InChI=1S/C35H46O6/c1-20(2)39-30-26-24(32(26,6)7)17-18-33(8)29(37)27-28(40-25(36)16-15-23-13-11-10-12-14-23)22(5)19-35(27,41-21(3)4)31(38)34(30,33)9/h10-16,22,24,26-30,37H,1,3,17-19H2,2,4-9H3/b16-15+/t22-,24-,26-,27+,28-,29+,30+,33-,34+,35+/m0/s1 |
| IUPAC | |
| Molecular Weight | 562.33 |
| Pubchem Id | 73348882 |
| Chembl Id | CHEMBL2385646 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL2385646 |
|
||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||
| Foods |
|
||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
