Showing entry for gigantamide A
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0045214 |
| Compound Name | gigantamide A |
| Structure | ![]() |
| Formula | C18H22N2O3 |
| InchiKey | BJWYJZGECNLLCG-MDZDMXLPSA-N |
| SMILES | OC1C=C(C(=O)N1CCCCN=C(/C=C/c1ccccc1)O)C |
| Inchi | InChI=1S/C18H22N2O3/c1-14-13-17(22)20(18(14)23)12-6-5-11-19-16(21)10-9-15-7-3-2-4-8-15/h2-4,7-10,13,17,22H,5-6,11-12H2,1H3,(H,19,21)/b10-9+ |
| IUPAC | |
| Molecular Weight | 314.16 |
| Pubchem Id | 23655945 |
| Chembl Id | CHEMBL249250 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL249250 |
|
||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||
| Foods |
|
||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
