Showing entry for n.a
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0045290 |
| Compound Name | n.a |
| Structure | ![]() |
| Formula | C19H30O7 |
| InchiKey | QPBOUUUYBCDTKI-WWXUAXTJSA-N |
| SMILES | OC[C@H]1O[C@@H](OC(C/C=C/2\C(=CC(=O)CC2(C)C)C)C)[C@@H]([C@H]([C@@H]1O)O)O |
| Inchi | InChI=1S/C19H30O7/c1-10-7-12(21)8-19(3,4)13(10)6-5-11(2)25-18-17(24)16(23)15(22)14(9-20)26-18/h6-7,11,14-18,20,22-24H,5,8-9H2,1-4H3/b13-6+/t11?,14-,15-,16+,17-,18-/m1/s1 |
| IUPAC | |
| Molecular Weight | 370.2 |
| Pubchem Id | 76310564 |
| Chembl Id | CHEMBL3114753 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL3114753 |
|
||||||||||||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||
| Foods |
|
||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
