Showing entry for n.a
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0045390 |
| Compound Name | n.a |
| Structure | ![]() |
| Formula | C18H34O10 |
| InchiKey | CMNGMGGJQXLNNS-BJNPHDPWSA-N |
| SMILES | CCCCC[C@@H](O[C@@H]1O[C@H](CO[C@@H]2OC[C@H]([C@@H]([C@H]2O)O)O)[C@H]([C@@H]([C@H]1O)O)O)C |
| Inchi | InChI=1S/C18H34O10/c1-3-4-5-6-9(2)27-18-16(24)14(22)13(21)11(28-18)8-26-17-15(23)12(20)10(19)7-25-17/h9-24H,3-8H2,1-2H3/t9-,10+,11+,12-,13+,14-,15+,16+,17-,18+/m0/s1 |
| IUPAC | |
| Molecular Weight | 410.22 |
| Pubchem Id | 118711819 |
| Chembl Id | CHEMBL3326717 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL3326717 |
|
||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||
| Foods |
|
||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
