Showing entry for n.a
| General Compound Information | |
|---|---|
| BXGC Id | BXGC0045427 |
| Compound Name | n.a |
| Structure | ![]() |
| Formula | C32H56O3 |
| InchiKey | NRHMKHNCVMMQCQ-YGBPDJJZSA-N |
| SMILES | COC(C(C)C)(CC[C@H]([C@H]1CC[C@@]2([C@]1(C)CC[C@@]13[C@H]2CC[C@@H]2[C@]3(C1)CC[C@@H](C2(C)C)O)C)C)CO |
| Inchi | InChI=1S/C32H56O3/c1-21(2)32(20-33,35-8)16-11-22(3)23-12-14-29(7)25-10-9-24-27(4,5)26(34)13-15-30(24)19-31(25,30)18-17-28(23,29)6/h21-26,33-34H,9-20H2,1-8H3/t22-,23-,24+,25+,26+,28-,29+,30-,31+,32?/m1/s1 |
| IUPAC | |
| Molecular Weight | 488.42 |
| Pubchem Id | 118723458 |
| Chembl Id | CHEMBL3359355 |
| Targets of Information Source | ||||||||||||||||||||||||||||||||||||||||||
| DrugBank | n.a |
|
||||||||||||||||||||||||||||||||||||||||
| PDB | n.a |
|
||||||||||||||||||||||||||||||||||||||||
| Binding DB | n.a |
|
||||||||||||||||||||||||||||||||||||||||
| CHEMBL | CHEMBL3359355 |
|
||||||||||||||||||||||||||||||||||||||||
| Foods containing the compound | |||||||||||||
| Foods |
|
||||||||||||
| The compound-realted diseases | ||||||
| Diseases |
|
|||||
